CymitQuimica logo

CAS 2417-42-7

:

Methanesulfonamide, N-(3-acetylphenyl)-

Description:
Methanesulfonamide, N-(3-acetylphenyl)-, also known by its CAS number 2417-42-7, is an organic compound characterized by the presence of a methanesulfonamide functional group attached to a 3-acetylphenyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of sulfonamides, including potential antibacterial activity, although its specific biological properties may vary. The presence of the acetyl group on the phenyl ring can influence its reactivity and interactions, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests it may participate in various chemical reactions, including acylation and nucleophilic substitutions. Safety data should be consulted for handling and exposure, as with all chemical substances, to ensure proper precautions are taken. Overall, Methanesulfonamide, N-(3-acetylphenyl)- is a compound of interest in both synthetic and pharmaceutical chemistry contexts.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-7(11)8-4-3-5-9(6-8)10-14(2,12)13/h3-6,10H,1-2H3
InChI key:UTNQCUWLQFFFSL-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC(=CC=C1)NS(=O)(=O)C
Found 2 products.