CAS 2417089-74-6

3-Acridinecarboxamide, 9-chloro-5,6,7,8-tetrahydro-N-[(4S)-5-[4-hydroxy-4-[[7-[[3-(4-methyl-1-piperazinyl)-1-oxopropyl]amino]-4-oxo-3(4H)-quinazolinyl]methyl]-1-piperidinyl]-5-oxo-4-(phenylmethyl)pentyl]-

Description:

3-Acridinecarboxamide, 9-chloro-5,6,7,8-tetrahydro-N-[(4S)-5-[4-hydroxy-4-[[7-[[3-(4-methyl-1-piperazinyl)-1-oxopropyl]amino]-4-oxo-3(4H)-quinazolinyl]methyl]-1-piperidinyl]-5-oxo-4-(phenylmethyl)pentyl]- is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, piperazines, and quinazolines. This compound is likely to exhibit significant biological activity due to its structural features, which may interact with various biological targets. The presence of a chloro group and multiple nitrogen-containing rings suggests potential pharmacological properties, possibly in the realm of medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, as well as the presence of other chemical entities. The compound's CAS number, 2417089-74-6, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases. Overall, this substance represents a noteworthy example of synthetic organic chemistry with potential applications in drug development.

Formula: C₄₈H₅₇ClN₈O₅

InChI: InChI=1S/C48H57ClN8O5/c1-54-24-26-55(27-25-54)21-17-43(58)52-36-14-16-39-41(30-36)51-32-57(47(39)61)31-48(62)18-22-56(23-19-48)46(60)35(28-33-8-3-2-4-9-33)10-7-20-50-45(59)34-13-15-38-42(29-34)53-40-12-6-5-11-37(40)44(38)49/h2-4,8-9,13-16,29-30,32,35,62H,5-7,10-12,17-28,31H2,1H3,(H,50,59)(H,52,58)/t35-/m0/s1

InChI key: UYJWYMWIVMCGQZ-DHUJRADRSA-N

SMILES: CN1CCN(CC1)CCC(=O)NC2=CC3=C(C=C2)C(=O)N(C=N3)CC4(CCN(CC4)C(=O)[C@@H](CCCNC(=O)C5=CC6=C(C=C5)C(=C7CCCCC7=N6)Cl)CC8=CC=CC=C8)O

Synonyms:

• XL177A
• 3-Acridinecarboxamide, 9-chloro-5,6,7,8-tetrahydro-N-[(4S)-5-[4-hydroxy-4-[[7-[[3-(4-methyl-1-piperazinyl)-1-oxopropyl]amino]-4-oxo-3(4H)-quinazolinyl]methyl]-1-piperidinyl]-5-oxo-4-(phenylmethyl)pentyl]-

XL177A

CAS: 2417089-74-6

XL177A

Formula: C₄₈H₅₇ClN₈O₅

Purity: ≥98%

Molecular weight: 861.47

Ref: 54-BUP03177

(S)-N-(4-Benzyl-5-(4-hydroxy-4-((7-(3-(4-methylpiperazin-1-yl)propanamido)-4-oxoquinazolin-3(4H)-yl)methyl)piperidin-1-yl)-5-oxopentyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carboxamide

CAS: 2417089-74-6

Formula: C₄₈H₅₇ClN₈O₅

Purity: 98%

Molecular weight: 861.4698

Ref: IN-DA01V4ND

XL177A

CAS: 2417089-74-6

XL177A is a selective irreversible USP7 inhibitor(IC50 : 0.34 nM). XL177A elicits cancer cell killing through a p53-dependent mechanism.

Formula: C₄₈H₅₇ClN₈O₅

Purity: 98.75% - 99.49%

Color and Shape: Yellow Solid

Molecular weight: 861.47

Ref: TM-T9122

XL177A

CAS: 2417089-74-6

XL177A is a peptide, which is a short chain of amino acids. It has been used as a research tool to investigate protein interactions and receptor-ligand binding. The structure of XL177A is unknown, but it has been shown to act as an inhibitor against ion channels.

Formula: C₄₈H₅₇ClN₈O₅

Purity: Min. 95%

Molecular weight: 861.5 g/mol

Ref: 3D-SWD08974