CymitQuimica logo

CAS 24237-34-1

:

Thieno[2,3-c]pyridine-3-carboxylic acid,2-amino-4,5,6,7-tetrahydro-6-(phenylmethyl)-, methyl ester

Description:
Thieno[2,3-c]pyridine-3-carboxylic acid, 2-amino-4,5,6,7-tetrahydro-6-(phenylmethyl)-, methyl ester, identified by CAS number 24237-34-1, is a complex organic compound characterized by its thieno and pyridine ring structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group and an ester moiety, indicating potential for reactivity and solubility in various solvents. The presence of the tetrahydro structure suggests it has a saturated cyclic component, which may influence its biological activity and stability. Additionally, the phenylmethyl group enhances its lipophilicity, potentially affecting its interaction with biological membranes. The amino group indicates that it may participate in hydrogen bonding, which can be crucial for its solubility and reactivity. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C16H18N2O2S
InChI:InChI=1S/C16H18N2O2S/c1-20-16(19)14-12-7-8-18(10-13(12)21-15(14)17)9-11-5-3-2-4-6-11/h2-6H,7-10,17H2,1H3
InChI key:QKWWVWMPMBDFBM-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(SC2=C1CCN(C2)CC3=CC=CC=C3)N
Found 1 products.