CAS 24241-18-7
:2-Amino-3,5-dibromopyrazine
Description:
2-Amino-3,5-dibromopyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of amino and dibromo substituents on the pyrazine ring significantly influences its chemical properties and reactivity. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science due to the reactivity of the amino group and the bromine atoms, which can participate in various chemical reactions such as nucleophilic substitutions or coupling reactions. The bromine substituents also enhance the compound's potential for use in synthesis and as a building block in organic chemistry. Additionally, the presence of the amino group can facilitate hydrogen bonding, affecting its physical properties and interactions with other molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C4H3Br2N3
InChI:InChI=1/C4H3Br2N3/c5-2-1-8-4(7)3(6)9-2/h1H,(H2,7,8)
SMILES:c1c(Br)nc(c(N)n1)Br
Synonyms:- 3,5-Dibromopyrazine-2-Ylamine
- 3,5-Dibromopyrazin-2-Amine
- 2-Amino-3,5-Dibromopyrazin
- 3,5-dibromo-2-Pyrazinamine
- 3,5-Dibromopyrazin-2-ylamine
- 3,5-Dibromo-2-Aminopyrazine
- Dibromopyrazin-2-amine,3,5-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Amino-3,5-dibromopyrazine
CAS:Formula:C4H3Br2N3Purity:>98.0%(GC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:252.902-Amino-3,5-dibromopyrazine
CAS:Formula:C4H3Br2N3Purity:98%Color and Shape:SolidMolecular weight:252.8947Ref: IN-DA00332W
5kgTo inquire5g20.00€10g26.00€25g30.00€50g43.00€100g64.00€250g122.00€500g186.00€1kg258.00€10kg1,488.00€25kg3,812.00€2-Amino-3,5-dibromopyrazine
CAS:2-Amino-3,5-dibromopyrazineFormula:C4H3Br2N3Purity:98%Color and Shape:SolidMolecular weight:252.894722-Amino-3,5-dibromopyrazine
CAS:Controlled ProductApplications 2-Amino-3,5-dibromopyrazine is used in the preparation of conjugated polymers for neurotoxin detection. 2-Amino-3,5-dibromopyrazine is an intermediate in the preparation of rho kinase (ROCK) inhibitors.
References Thomas, J. et al.: Polym. Prepr., 46, 1211 (2005); Henderson, A.J. et al.: Bioorg. Med. Chem. Lett., 20, 1137 (2010);Formula:C4H3Br2N3Color and Shape:NeatMolecular weight:252.8952-Amino-3,5-dibromopyrazine
CAS:Formula:C4H3Br2N3Purity:96%Color and Shape:SolidMolecular weight:252.897Amino-3,5-dibromopyrazine
CAS:2-Amino-3,5-dibromopyrazineFormula:C4H3Br2N3Purity:98%Molecular weight:252.893,5-Dibromopyrazin-2-amine
CAS:3,5-Dibromopyrazin-2-amine is a triethyl orthoformate derivative that reacts with formamide to form 3,5-dibromopyrazine. The reaction time is typically less than 10 minutes and the yield is high. The product can be stored in a dry, inert atmosphere for up to 3 months without degradation. The compound has been shown to inhibit cyclic nucleotide phosphodiesterase (PDE) enzymes and cancer cells in vitro.
Formula:C4H3Br2N3Purity:Min. 95%Color and Shape:White To Yellow To Orange SolidMolecular weight:252.89 g/mol







