
CAS 24250-85-9
:4-iodo-L-phenylalanine
Description:
4-Iodo-L-phenylalanine is an amino acid derivative characterized by the presence of an iodine atom at the para position of the phenyl ring of phenylalanine. Its molecular formula is C9H10INO2, indicating that it contains a phenyl group, an amino group, and a carboxylic acid group, typical of amino acids. This compound is notable for its potential applications in biochemical research, particularly in studies involving protein synthesis and modification, as the iodine substitution can influence the properties of peptides and proteins. The presence of iodine can also enhance the compound's ability to participate in various chemical reactions, including those involving halogenation or electrophilic aromatic substitution. Additionally, 4-iodo-L-phenylalanine may exhibit unique spectroscopic properties due to the iodine atom, making it useful in analytical chemistry. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Overall, 4-iodo-L-phenylalanine serves as a valuable tool in both synthetic and analytical chemistry contexts.
Formula:C9H10INO2
InChI:InChI=1/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1
SMILES:c1cc(ccc1C[C@H](C(=O)O)N)I
Synonyms:- H-p-Iodo-Phe-OH
- H-Phe(4-I)-OH
- L-4-Iodophe
- L-4-Iodophenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
H-Phe(4-I)-OH
CAS:Formula:C9H10INO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:291.094-Iodo-L-phenylalanine, 95%
CAS:4-Iodo-L-phenylalanine may be used in protein engineering as a model unnatural amino acid to alter primary amino acid composition via the opal (UGA) codon. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informatioFormula:C9H10INO2Purity:95%Molecular weight:291.09H-p-Iodo-Phe-OH
CAS:Educt for synthesizing Ar-modified phenylalanines by Suzuki-Miyaura coupling. p-Iodo-L-phenylalanine has been incorporated site-specifically into proteins for structure determination.Formula:C9H10INO2Purity:> 99%Color and Shape:Whitish PowderMolecular weight:291.09Ref: IN-DA00I4O2
1g24.00€5g40.00€10g54.00€25g97.00€50g150.00€100g205.00€250g657.00€1kg1,851.00€5kg8,080.00€4-Iodo-L-phenylalanine
CAS:4-Iodo-L-phenylalanineFormula:C9H10INO2Purity:≥95%Color and Shape:SolidMolecular weight:291.085674-Iodo-L-phenylalanine
CAS:Formula:C9H10INO2Purity:≥ 96.0%Color and Shape:White to off-white powderMolecular weight:291.094-Iodo-phenylalanine
CAS:M03183 - 4-Iodo-phenylalanine
Formula:C9H10INO2Purity:96%Color and Shape:Light yellow powderMolecular weight:291.0884-Iodo-L-phenylalanine
CAS:4-Iodo-L-phenylalanine is an unlabeled amino acid that has been shown to inhibit the protein synthesis of cancer cells. It binds to the thrombin receptor and inhibits the activation of proteases, thereby inhibiting cancer cell growth. 4-Iodo-L-phenylalanine also inhibits translation by binding to the ribosome during the translation process and binding to the hydroxyl group on a mRNA molecule during transcription. This inhibition leads to a decrease in protein synthesis and cell proliferation.Formula:C9H10INO2Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:291.09 g/mol









