CAS 2426-84-8
:4-(benzyloxy)-5-methoxy-2-nitrobenzaldehyde
Description:
4-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde, with the CAS number 2426-84-8, is an organic compound characterized by its complex aromatic structure. It features a benzaldehyde functional group, which is a key characteristic of aldehydes, contributing to its reactivity and potential applications in organic synthesis. The presence of a nitro group (-NO2) at the 2-position and methoxy (-OCH3) and benzyloxy (-OPh) substituents at the 5- and 4-positions, respectively, enhances its electrophilic properties and influences its solubility and polarity. This compound is typically a yellow to orange solid, and its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution, making it a versatile building block in synthetic chemistry. Additionally, the presence of multiple functional groups allows for further derivatization, expanding its utility in research and industrial applications.
Formula:C15H13NO5
InChI:InChI=1/C15H13NO5/c1-20-14-7-12(9-17)13(16(18)19)8-15(14)21-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3
SMILES:COc1cc(C=O)c(cc1OCc1ccccc1)N(=O)=O
Synonyms:- Benzaldehyde, 4-benzyloxy-5-methoxy-2-nitro-
- Benzaldehyde, 5-Methoxy-2-Nitro-4-(Phenylmethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde
CAS:4-(Benzyloxy)-5-methoxy-2-nitrobenzaldehydeFormula:C15H13NO5Purity:≥95%Color and Shape:SolidMolecular weight:287.267424-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde
CAS:Formula:C15H13NO5Purity:98%Color and Shape:SolidMolecular weight:287.26744-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde
CAS:4-(Benzyloxy)-5-methoxy-2-nitrobenzaldehydeFormula:C15H13NO5Purity:95%Molecular weight:287.274-(benzyloxy)-5-methoxy-2-nitrobenzaldehyde
CAS:Formula:C15H13NO5Purity:98%Color and Shape:SolidMolecular weight:287.2714-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde
CAS:4-(Benzyloxy)-5-methoxy-2-nitrobenzaldehyde (BOMBA) is an amide with affinity for microtubules. It has been shown to interact with the microtubule lattice and inhibit the polymerization of tubulin. This leads to a decrease in cell viability and cytotoxicity, as well as a decrease in tumor size. In vivo studies have demonstrated that BOMBA inhibits tumor growth by inducing thrombosis and coagulation, which results in reduced blood flow to the tumor. The mechanism of action of BOMBA is thought to be due to its ability to form sulfamates, which are known for their anti-coagulant activity.Formula:C15H13NO5Purity:Min. 95%Molecular weight:287.27 g/mol




