CAS 24279-39-8
:2,6-Dichloro-4-trifluoromethylaniline
Description:
2,6-Dichloro-4-trifluoromethylaniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The compound contains two chlorine atoms and one trifluoromethyl group (-CF3) at specific positions on the aromatic ring, contributing to its unique chemical properties. It is typically a solid at room temperature and is known for its potential applications in the synthesis of agrochemicals and pharmaceuticals. The presence of halogen substituents enhances its reactivity and can influence its solubility and stability in various solvents. Additionally, the trifluoromethyl group is known to impart significant lipophilicity, which can affect the compound's biological activity and environmental behavior. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. As with many halogenated compounds, it may also exhibit persistence in the environment, necessitating careful consideration in its use and disposal.
Formula:C7H4Cl2F3N
InChI:InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2
InChI key:InChIKey=ITNMAZSPBLRJLU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(Cl)=C(N)C(Cl)=C1
Synonyms:- 2,6-Dichloro-4-(trifluoromethyl)benzenamine
- 2,6-Dichloro-4-trifluoromethylaniline
- 3,5-Dichloro-4-Amino Benzotrifluoride
- 4-Amino-3,5-dichlorobenzotrifluoride
- Benzenamine, 2,6-dichloro-4-(trifluoromethyl)-
- p-Toluidine, 2,6-dichloro-α,α,α-trifluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-3,5-dichlorobenzotrifluoride
CAS:4-Amino-3,5-dichlorobenzotrifluorideFormula:C7H4Cl2F3NPurity:97%Color and Shape:Solid-CrystalsMolecular weight:230.014564-Amino-3,5-dichlorobenzotrifluoride
CAS:Formula:C7H4Cl2F3NPurity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to lumpMolecular weight:230.012,6-Dichloro-4-(trifluoromethyl)aniline
CAS:Formula:C7H4Cl2F3NPurity:99.0%Color and Shape:SolidMolecular weight:230.012,6-Dichloro-4-(trifluoromethyl)aniline
CAS:Controlled ProductApplications 2,6-Dichloro-4-(trifluoromethyl)aniline is used in the synthesis of GABA receptor antagonists and insecticides.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Sammelson, R. et al.: Bioorg. Med. Chem., 12, 3345 (2004); Huang, W. et al.: Bioorg. Med. Chem., 14, 8280 (2006);Formula:C7H4Cl2F3NColor and Shape:NeatMolecular weight:230.0142,6-Dichloro-4-(trifluoromethyl)aniline
CAS:2,6-Dichloro-4-(trifluoromethyl)aniline is a colorless solid that is soluble in organic solvents. It is used as an absorber of chloride gas and other gases. 2,6-Dichloro-4-(trifluoromethyl)aniline reacts with hydrochloric acid to produce diazonium salt and chloride ions. The diazonium salt reacts with organic solvent and hydrogen gas to form the reaction products. In the presence of carbon dioxide and hydrogen chloride, 2,6-dichloro-4-(trifluoromethyl)aniline undergoes chlorinating reactions to produce hydrogen chloride gas and the chlorinated product.Formula:C7H4Cl2F3NPurity:Min. 95%Color and Shape:PowderMolecular weight:230.01 g/mol2,6-Dichloro-4-(trifluoromethyl)aniline
CAS:2,6-Dichloro-4-(trifluoromethyl)anilineFormula:C7H4Cl2F3NPurity:98%Molecular weight:230.01






