CAS 2433-56-9
:1-Hydroxyphenanthrene
Description:
1-Hydroxyphenanthrene is an organic compound characterized by its phenanthrene backbone with a hydroxyl (-OH) group attached to one of the aromatic rings. This compound is a polycyclic aromatic hydrocarbon (PAH) derivative, which contributes to its chemical properties and reactivity. It typically appears as a solid at room temperature and is sparingly soluble in water but more soluble in organic solvents. The presence of the hydroxyl group enhances its potential for hydrogen bonding, influencing its physical properties and reactivity. 1-Hydroxyphenanthrene is of interest in various fields, including environmental chemistry, due to its formation from the degradation of larger PAHs, and in biological studies, as it may exhibit biological activity. Its structure allows for potential interactions with biological systems, making it a subject of research in toxicology and pharmacology. Additionally, it can serve as a precursor or intermediate in the synthesis of other chemical compounds. Safety and handling precautions are essential due to its classification and potential health effects associated with PAHs.
Formula:C14H10O
InChI:InChI=1S/C14H10O/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9,15H
InChI key:InChIKey=GTBXZWADMKOZQJ-UHFFFAOYSA-N
SMILES:OC=1C=2C(=C3C(=CC2)C=CC=C3)C=CC1
Synonyms:- 1-Hydroxyphenanthrene
- 1-Phenanthrenol
- 1-Phenanthrenol (9CI)
- 1-Phenanthrol
- NSC 44471
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Phenanthrol
CAS:1-Phenanthrol is a naturally occurring phenanthrene derivative that is used in the treatment of cervical cancer. It has been shown to be effective in the chemiluminescence method using urine samples, which indicates that it may have an effect on the body's metabolism. 1-Phenanthrol has also been shown to inhibit the production of s-phenylmercapturic acid, which is a metabolite of aromatic amines. This inhibition may be due to its receptor binding properties as it binds to and activates the peroxisome proliferator-activated receptor alpha (PPARα) and PPARγ. 1-Phenanthrol also inhibits angiotensin II type 1 receptors and can cause vasorelaxation by reducing blood pressure.
Formula:C14H10OPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:194.23 g/mol







