CymitQuimica logo

CAS 2435781-94-3

:

2-Pyridineacetamide, N-[5-[4-[6-[[3-[1-[(4-methylphenyl)methyl]-1H-1,2,3-triazol-4-yl]-1-oxopropyl]amino]-3-pyridazinyl]butyl]-1,3,4-thiadiazol-2-yl]-

Description:
2-Pyridineacetamide, N-[5-[4-[6-[[3-[1-[(4-methylphenyl)methyl]-1H-1,2,3-triazol-4-yl]-1-oxopropyl]amino]-3-pyridazinyl]butyl]-1,3,4-thiadiazol-2-yl]- (CAS 2435781-94-3) is a complex organic compound characterized by its multi-functional structure, which includes a pyridine ring, a triazole moiety, and a thiadiazole unit. This compound is likely to exhibit a range of biological activities due to its diverse functional groups, making it of interest in medicinal chemistry and drug development. The presence of nitrogen-containing heterocycles suggests potential interactions with biological targets, such as enzymes or receptors. Additionally, the compound's solubility, stability, and reactivity can be influenced by its structural features, including the presence of aromatic rings and various substituents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be evaluated for pharmacological properties in preclinical studies. Overall, this compound represents a class of molecules that could have significant implications in therapeutic applications.
Formula:C30H32N10O2S
InChI:InChI=1S/C30H32N10O2S/c1-21-9-11-22(12-10-21)19-40-20-25(35-39-40)14-16-27(41)32-26-15-13-23(34-36-26)6-2-3-8-29-37-38-30(43-29)33-28(42)18-24-7-4-5-17-31-24/h4-5,7,9-13,15,17,20H,2-3,6,8,14,16,18-19H2,1H3,(H,32,36,41)(H,33,38,42)
InChI key:KDLYXJILURZOHN-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)CN2C=C(N=N2)CCC(=O)NC3=NN=C(C=C3)CCCCC4=NN=C(S4)NC(=O)CC5=CC=CC=N5
Synonyms:
  • 2-Pyridineacetamide, N-[5-[4-[6-[[3-[1-[(4-methylphenyl)methyl]-1H-1,2,3-triazol-4-yl]-1-oxopropyl]amino]-3-pyridazinyl]butyl]-1,3,4-thiadiazol-2-yl]-
  • GLS1 Inhibitor-3
Found 1 products.