CAS 2437-79-8: PCB 47
Description:PCB 47, also known by its Chemical Abstracts Service (CAS) number 2437-79-8, is a polychlorinated biphenyl (PCB) compound. PCBs are a group of synthetic organic chemicals that consist of carbon, hydrogen, and chlorine atoms. PCB 47 is characterized by its biphenyl structure, where two benzene rings are connected by a single bond, with chlorine atoms substituted at specific positions on the rings. This compound is typically colorless to light yellow and is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. PCBs, including PCB 47, are known for their stability and resistance to degradation, which has led to their widespread historical use in electrical equipment, heat transfer fluids, and other industrial applications. However, due to their environmental persistence and potential health risks, including carcinogenic effects and endocrine disruption, PCBs have been banned or heavily regulated in many countries. PCB 47, like other PCBs, poses challenges for environmental remediation and public health.
Formula:C12H6Cl4
InChI:InChI=1S/C12H6Cl4/c13-7-1-3-9(11(15)5-7)10-4-2-8(14)6-12(10)16/h1-6H
InChI key:InChIKey=QORAVNMWUNPXAO-UHFFFAOYSA-N
SMILES:ClC=1C=CC(=C(Cl)C1)C2=CC=C(Cl)C=C2Cl
- Synonyms:
- 1,1'-Biphenyl, 2,2',4,4'-tetrachloro-
- 1,1′-Biphenyl, 2,2′,4,4′-tetrachloro-
- 2,2',4,4'-Tetrachlorbiphenyl
- 2,2',4,4'-Tetrachlorobiphenyle
- 2,2',4,4'-Tetrachlorodiphenyl
- 2,2',4,4'-Tetraclorobifenilo
- 2,2′,4,4′-Tetrachloro-1,1′-biphenyl
- 2,2′,4,4′-Tetrachlorobiphenyl
- 2,2′,4,4′-Tetrachlorodiphenyl
- 2,4,2',4'-Tetrachlorobiphenyl
- See more synonyms
- Biphenyl, 2,2',4,4'-tetrachloro-
- Biphenyl, 2,2′,4,4′-tetrachloro-
- Cb 47
- Pcb 47
- 2,2',4,4'-Tetrachlorobiphenyl
