CAS 244-69-9: pyrido[4,3-b]indole
Description:Pyrido[4,3-b]indole is a heterocyclic organic compound characterized by its fused pyridine and indole structures. This compound features a bicyclic framework that contributes to its unique chemical properties. It typically exhibits a planar structure, which can facilitate interactions with biological targets, making it of interest in medicinal chemistry. Pyrido[4,3-b]indole is known for its potential biological activities, including antitumor and antimicrobial properties, which have been explored in various studies. The compound is generally soluble in organic solvents, and its reactivity can be influenced by the presence of functional groups on the indole or pyridine moieties. Additionally, it may undergo various chemical transformations, such as oxidation or substitution reactions, depending on the reaction conditions. Its distinct structure and properties make pyrido[4,3-b]indole a subject of interest in both synthetic organic chemistry and pharmacological research.
Formula:C11H8N2
InChI:InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-7,13H
- Synonyms:
- Gamma-Carboline
- 5H-pyrido[4,3-b]indole
- 3-Azacarbazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5H-Pyrido[4,3-b]indole REF: 3B-P2362CAS: 244-69-9 | >98.0%(GC) | 75.00 €~224.00 € | Wed 26 Mar 25 |
![]() | 5H-Pyrido[4,3-b]indole REF: IN-DA007N3GCAS: 244-69-9 | 98% | To inquire | Wed 02 Apr 25 |
![]() | 5H-Pyrido[4,3-b]indole REF: 54-OR951880CAS: 244-69-9 | 98% | 34.00 €~2,253.00 € | Wed 09 Apr 25 |
![]() | 5H-Pyrido[4,3-b]indole REF: 10-F301540CAS: 244-69-9 | 97.0% | To inquire | Mon 14 Apr 25 |
![]() | 5H-Pyrido[4,3-b]indole REF: 3D-AAA24469CAS: 244-69-9 | Min. 95% | - - - | Discontinued product |

5H-Pyrido[4,3-b]indole
Ref: 3B-P2362
1g | 224.00 € | ||
200mg | 75.00 € |

5H-Pyrido[4,3-b]indole
Ref: IN-DA007N3G
1g | 45.00 € | ||
5g | 95.00 € | ||
25g | 276.00 € | ||
100g | To inquire | ||
100mg | 25.00 € | ||
250mg | 26.00 € |

Ref: 54-OR951880
1g | 34.00 € | ||
5g | 143.00 € | ||
25g | 622.00 € | ||
100g | 2,253.00 € |

5H-Pyrido[4,3-b]indole
Ref: 10-F301540
1g | 32.00 € | ||
5g | 144.00 € | ||
10g | 259.00 € | ||
25g | To inquire |

5H-Pyrido[4,3-b]indole
Ref: 3D-AAA24469
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |