CymitQuimica logo

CAS 244014-85-5

:

Thieno[2,3-b]pyrazine-6-carboxylicacid, 7-amino-, methyl ester

Description:
Thieno[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, methyl ester is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both thieno and pyrazine moieties. This compound features a carboxylic acid functional group that is esterified with a methyl group, as well as an amino group at the 7-position of the pyrazine ring. The presence of these functional groups contributes to its potential reactivity and solubility properties. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thieno and pyrazine rings can participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, which may enhance their utility in synthetic applications. Additionally, the compound's molecular structure may influence its interaction with biological targets, potentially leading to pharmacological effects. Overall, thieno[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, methyl ester represents a versatile scaffold for further chemical modifications and investigations in various fields of research.
Formula:C8H7N3O2S
InChI:InChI=1S/C8H7N3O2S/c1-13-8(12)6-4(9)5-7(14-6)11-3-2-10-5/h2-3H,9H2,1H3
InChI key:PSFBMJMQOVCYFD-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C2=NC=CN=C2S1)N
Synonyms:
  • Thieno[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, methyl ester (9CI)
Found 4 products.