CAS 2441-63-6

glycyl-L-prolylglycine

Description:

Glycyl-L-prolylglycine, with the CAS number 2441-63-6, is a dipeptide composed of the amino acids glycine and proline. This compound is characterized by its unique structure, which includes a glycine residue at both the N-terminus and C-terminus, with proline in the middle. The presence of proline introduces a distinctive cyclic structure that can influence the peptide's conformation and stability. Glycyl-L-prolylglycine is soluble in water and exhibits properties typical of peptides, such as the ability to form hydrogen bonds and engage in various interactions with biological macromolecules. It may play a role in biological processes, including protein synthesis and cellular signaling. Additionally, due to its structural characteristics, it can be involved in the modulation of physiological functions. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it relevant in both biochemical research and potential therapeutic applications.

Formula: C₉H₁₅N₃O₄

InChI: InChI=1/C9H15N3O4/c10-4-7(13)12-3-1-2-6(12)9(16)11-5-8(14)15/h6H,1-5,10H2,(H,11,16)(H,14,15)/t6-/m0/s1

SMILES: C1C[C@@H](C(=NCC(=O)O)O)N(C1)C(=O)CN

Synonyms:

• glycine, glycyl-L-prolyl-
• H-Gly-Pro-Gly-OH
• Glycyl-L-prolylglycine

H-Gly-Pro-Gly-OH

CAS: 2441-63-6

Bachem ID: 4016165.

Formula: C₉H₁₅N₃O₄

Purity: 99.9%

Molecular weight: 229.24

Ref: 01-4016165

H-Gly-Pro-Gly-OH

CAS: 2441-63-6

Formula: C₉H₁₅N₃O₄

Molecular weight: 229.2331

Ref: IN-DA019FW4

H-Gly-Pro-Gly-OH

CAS: 2441-63-6

H-Gly-Pro-Gly-OH is a glycan molecule. It is an artificially synthesized glycan that was designed to act as a neutralizing agent for HIV. It binds to the envelope protein gp120 and prevents it from binding to CD4 receptors on cells, thereby preventing viral entry into the cell. H-Gly-Pro-Gly-OH has also been shown to be effective in neutralizing collagenase activity, which may be useful in treating arthritis and other autoimmune disorders. H-Gly-Pro-Gly-OH has been shown to bind to monoclonal antibodies that are used in the development of cancer treatments, such as Herceptin and Erbitux. This binding is thought to be due to sequences within the antibody that correspond with those found on gp120, the envelope protein of HIV.

Formula: C₉H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 229.23 g/mol

Ref: 3D-FG110452