CAS 24455-93-4
:N-(4-methoxyphenyl)ethane-1,2-diamine
Description:
N-(4-methoxyphenyl)ethane-1,2-diamine, with the CAS number 24455-93-4, is an organic compound characterized by its amine functional groups and a methoxy-substituted aromatic ring. This compound features a two-carbon ethane backbone with amino groups (-NH2) at the first and second carbon positions, and a para-methoxy group (-OCH3) attached to the aromatic ring. The presence of the methoxy group enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals due to their ability to interact with biological systems. The molecular structure suggests that it may participate in hydrogen bonding, which can affect its physical properties, such as melting and boiling points. Additionally, the compound's stability and reactivity can be influenced by the electron-donating nature of the methoxy group, making it a subject of interest in various chemical research fields.
Formula:C9H14N2O
InChI:InChI=1/C9H14N2O/c1-12-9-4-2-8(3-5-9)11-7-6-10/h2-5,11H,6-7,10H2,1H3
SMILES:COc1ccc(cc1)NCCN
Synonyms:- 1,2-ethanediamine, N~1~-(4-methoxyphenyl)-
- N-(4-Methoxyphenyl)ethane-1,2-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N1-(4-Methoxyphenyl)ethane-1,2-diamine
CAS:N1-(4-Methoxyphenyl)ethane-1,2-diamineFormula:C9H14N2OPurity:95%Molecular weight:166.22N-(4-Methoxyphenyl)ethane-1,2-diamine
CAS:Formula:C9H14N2OPurity:95%Color and Shape:SolidMolecular weight:166.2203N1-(4-Methoxyphenyl)ethane-1,2-diamine
CAS:N1-(4-Methoxyphenyl)ethane-1,2-diamineFormula:C9H14N2OPurity:95%Molecular weight:166.22N-(4-Methoxyphenyl)ethane-1,2-diamine
CAS:N-(4-Methoxyphenyl)ethane-1,2-diamine is a synthetic compound that has been shown to inhibit the activity of cathepsins. It can be used in the treatment of diseases caused by these enzymes, such as osteoarthritis and Alzheimer's disease. N-(4-Methoxyphenyl)ethane-1,2-diamine has a pharmacokinetic profile that is favorable for oral administration. The drug is absorbed from the gastrointestinal tract readily and undergoes extensive metabolism in the liver. This process leads to the formation of active metabolites which are excreted in urine or bile. N-(4-Methoxyphenyl)ethane-1,2-diamine also inhibits nitroalkanes with activated aromatic rings, such as 4-nitrobenzaldehyde and 2,4,6-trinitrobenzene.Formula:C9H14N2OPurity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:166.22 g/mol




