CymitQuimica logo

CAS 246177-37-7

:

Benzo[b]thiophene-5-carboxylic acid, 4-hydroxy-, methyl ester

Description:
Benzo[b]thiophene-5-carboxylic acid, 4-hydroxy-, methyl ester, identified by CAS number 246177-37-7, is an organic compound characterized by its unique structure that incorporates a benzo[b]thiophene moiety. This compound features a carboxylic acid functional group and a methoxy group, which contribute to its chemical reactivity and potential applications. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. Benzo[b]thiophenes are known for their aromatic properties and can exhibit interesting electronic characteristics, making them relevant in materials science and organic electronics. Additionally, derivatives of benzo[b]thiophene have been studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. The methyl ester form of this compound may also facilitate easier handling and incorporation into various chemical reactions. Overall, this compound's structural features suggest it could be of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C10H8O3S
InChI:InChI=1S/C10H8O3S/c1-13-10(12)7-2-3-8-6(9(7)11)4-5-14-8/h2-5,11H,1H3
InChI key:RAWQGMFTJYIMMQ-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C2=C(C=C1)SC=C2)O
Found 2 products.