CAS 24621-61-2
:(+)-1,3-Butanediol
Description:
(+)-1,3-Butanediol, with the CAS number 24621-61-2, is a chiral organic compound characterized by its two hydroxyl (-OH) functional groups, making it a diol. It is a colorless, viscous liquid that is soluble in water and exhibits hygroscopic properties. The compound has a sweet taste and is often used in the food and cosmetic industries as a humectant and solvent. Its molecular structure allows for the formation of hydrogen bonds, contributing to its high boiling point relative to its molecular weight. Additionally, (+)-1,3-butanediol is known for its potential applications in pharmaceuticals and as a building block in organic synthesis. The presence of chirality in this compound means it can exist in two enantiomeric forms, with the (+) designation indicating its specific optical activity. Overall, (+)-1,3-butanediol is valued for its versatility and functional properties in various industrial applications.
Formula:C4H10O2
InChI:InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3/t4-/m0/s1
InChI key:InChIKey=PUPZLCDOIYMWBV-BYPYZUCNSA-N
SMILES:C([C@H](C)O)CO
Synonyms:- (+)-1,3-Butanediol
- (3S)-1,3-Butanediol
- (3S)-Butane-1,3-diol
- (S)-(+)-1,3-Butandiol
- (S)-(+)-1,3-Butanediol
- (S)-2,4-Butanediol
- 1,3-Butanediol, (3S)-
- 1,3-Butanediol, (S)-
- <span class="text-smallcaps">D</span>-Butane-1,3-diol
- D-Butane-1,3-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(S)-(+)-1,3-Butanediol
CAS:Formula:C4H10O2Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:90.12(S)-1,3-Butanediol
CAS:(S)-1,3-ButanediolFormula:C4H10O2Purity:98%,ee 97%Color and Shape:SolidMolecular weight:90.121(S)-(+)-1,3-Butanediol, 98+%
CAS:(S)-(+)-1,3-Butanediol, 98+%
Formula:CH3CH(OH)CH2CH2OHPurity:98+%Color and Shape:colorless liq.Molecular weight:90.12(S)-(+)-1,3-Butanediol
CAS:(S)-(+)-1,3-Butanediol is an organic compound that is classified as a diol. It is a chiral compound and has a stereocenter in the (R) configuration. The molecule can be synthesized by reduction of 1,4-butanediol with lithium aluminum hydride or sodium borohydride. This process involves two steps: dehydrogenation followed by reduction. The product of this reaction is racemic-1,3-butanediol. In one study, the enzyme escherichia coli cells were used to immobilize the alcohol in order to produce a catalyst for asymmetric synthesis. The affinity of these enzymes was found to be dependent on the concentration of butanediol.Formula:C4H10O2Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:90.12 g/mol(S)-(+)-1,3-Butanediol
CAS:Formula:C4H10O2Purity:95%Color and Shape:Liquid, ClearMolecular weight:90.122







