CymitQuimica logo

CAS 24623-20-9

:

6-methyl-1-indanone

Description:
6-Methyl-1-indanone is an organic compound characterized by its indanone structure, which consists of a fused benzene and cyclopentanone ring system. It features a methyl group attached to the 6-position of the indanone framework. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as sweet and floral. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. 6-Methyl-1-indanone is of interest in various fields, including fragrance and flavor industries, due to its pleasant aroma. Additionally, it may serve as an intermediate in organic synthesis, contributing to the development of more complex molecules. The compound's reactivity is influenced by the presence of the carbonyl group, making it susceptible to nucleophilic attacks and other chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H10O
InChI:InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3
InChI key:DBOXRDYLMJMQBB-UHFFFAOYSA-N
SMILES:Cc1ccc2CCC(=O)c2c1
Synonyms:
  • 6-methyl-2,3-dihydro-1H-inden-1-one
Found 5 products.