CymitQuimica logo

CAS 247021-90-5

:

Weinreb Linker

Description:
The Weinreb linker, identified by the CAS number 247021-90-5, is a chemical compound commonly used in organic synthesis, particularly in the field of peptide and small molecule synthesis. It is characterized by its ability to facilitate the formation of amides and other coupling reactions, often serving as a protective group for amines. The structure typically features a carbonyl group adjacent to a nitrogen atom, which can be utilized in various coupling reactions to create more complex molecular architectures. The Weinreb linker is valued for its stability under a range of reaction conditions and its compatibility with various functional groups, making it a versatile tool in synthetic organic chemistry. Its application extends to the synthesis of complex natural products and pharmaceuticals, where precise control over functionalization is crucial. Overall, the Weinreb linker exemplifies the importance of strategic molecular design in advancing synthetic methodologies.
Formula:C19H19NO5
InChI:InChI=1S/C19H19NO5/c1-24-20(11-10-18(21)22)19(23)25-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17H,10-12H2,1H3,(H,21,22)
InChI key:ROUNCJXPHYHPTH-UHFFFAOYSA-N
SMILES:CON(CCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Synonyms:
  • N-Fmoc-N-Methoxy-3-aminopropionic acid
  • N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methoxy-beta-alanine
Found 6 products.