CymitQuimica logo

CAS 24704-57-2

:

Methan-d3-ol,acetate (6CI,9CI)

Description:
Methan-d3-ol, acetate (6CI, 9CI), with the CAS number 24704-57-2, is a deuterated derivative of methanol, where three hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This compound is characterized by its molecular structure, which includes a methanol backbone with an acetate functional group. The presence of deuterium makes it useful in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques, as it provides distinct spectral characteristics compared to its non-deuterated counterparts. The acetate group contributes to its reactivity, allowing it to participate in esterification and other organic reactions. Methan-d3-ol, acetate is typically used in research settings, particularly in studies involving isotopic labeling, which can help trace metabolic pathways or reaction mechanisms. Its physical properties, such as boiling point and solubility, may differ from those of regular methanol due to the isotopic substitution, influencing its behavior in chemical reactions and interactions with other substances.
Formula:C3H3D3O2
InChI:InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3/i2D3
InChI key:KXKVLQRXCPHEJC-BMSJAHLVSA-N
SMILES:[2H]C([2H])([2H])OC(=O)C
Synonyms:
  • Aceticacid, methyl-d3 ester (8CI)
  • Methyl-d3 acetate
Found 1 products.