CymitQuimica logo

CAS 247129-88-0

:

Sulfonium, ethenyldiphenyl-, 1,1,1-trifluoromethanesulfonate (1:1)

Description:
Sulfonium, ethenyldiphenyl-, 1,1,1-trifluoromethanesulfonate (1:1), with the CAS number 247129-88-0, is a chemical compound characterized by its sulfonium cation derived from ethenyldiphenyl and a trifluoromethanesulfonate anion. This compound typically exhibits properties associated with sulfonium salts, such as high reactivity and stability under certain conditions. The presence of the trifluoromethanesulfonate group imparts unique characteristics, including enhanced solubility in polar solvents and potential applications in organic synthesis as a leaving group or in electrophilic reactions. The trifluoromethyl group contributes to the compound's electron-withdrawing properties, which can influence its reactivity and interaction with nucleophiles. Additionally, sulfonium compounds are often utilized in various fields, including materials science and pharmaceuticals, due to their ability to participate in cationic polymerization and other chemical transformations. Overall, this compound is of interest for its potential applications in synthetic chemistry and material development.
Formula:C14H13S·CF3O3S
InChI:InChI=1S/C14H13S.CHF3O3S/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;2-1(3,4)8(5,6)7/h2-12H,1H2;(H,5,6,7)/q+1;/p-1
InChI key:InChIKey=OKDGDBRZMJNKLV-UHFFFAOYSA-M
SMILES:[S+](C=C)(C1=CC=CC=C1)C2=CC=CC=C2.C(S(=O)(=O)[O-])(F)(F)F
Synonyms:
  • Sulfonium, ethenyldiphenyl-, 1,1,1-trifluoromethanesulfonate (1:1)
  • Diphenylvinylsulfonium triflate
  • Vinyldiphenylsulfonium triflate
  • Sulfonium, ethenyldiphenyl-, salt with trifluoromethanesulfonic acid (1:1)
Found 5 products.