CymitQuimica logo

CAS 24730-88-9

:

1,4-Dioxaspiro[4.5]decane-8-carboxylic acid, 8-methyl-, ethyl ester

Description:
1,4-Dioxaspiro[4.5]decane-8-carboxylic acid, 8-methyl-, ethyl ester, identified by CAS number 24730-88-9, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane ring fused to a decane framework. This compound features an ethyl ester functional group, contributing to its potential solubility in organic solvents and its reactivity in esterification and hydrolysis reactions. The presence of the carboxylic acid moiety indicates that it can participate in acid-base reactions and may serve as a precursor for various synthetic pathways. Additionally, the methyl group at the 8-position can influence the compound's steric and electronic properties, potentially affecting its biological activity and interactions. This compound may be of interest in fields such as medicinal chemistry, materials science, or organic synthesis, where its unique structural features could be leveraged for the development of novel compounds or materials. However, specific applications and biological activities would require further investigation and research.
Formula:C12H20O4
InChI:InChI=1S/C12H20O4/c1-3-14-10(13)11(2)4-6-12(7-5-11)15-8-9-16-12/h3-9H2,1-2H3
InChI key:VFWAGFFGWYTECB-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CCC2(CC1)OCCO2)C
Found 4 products.