CymitQuimica logo

CAS 24744-97-6

:

ethyl 2-[hydroxy(phenyl)methyl]butanoate

Description:
Ethyl 2-[hydroxy(phenyl)methyl]butanoate, with the CAS number 24744-97-6, is an organic compound characterized by its ester functional group and a complex structure that includes a butanoate moiety and a hydroxyphenyl group. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its ester nature. It possesses a distinctive aromatic character due to the presence of the phenyl group, which can influence its reactivity and interactions with other substances. Ethyl 2-[hydroxy(phenyl)methyl]butanoate may exhibit various chemical properties, including potential hydrogen bonding due to the hydroxyl group, which can affect its boiling point and solubility. Additionally, it may participate in typical ester reactions, such as hydrolysis or transesterification. The compound's unique structure suggests potential applications in organic synthesis, pharmaceuticals, or as a flavoring agent, although specific applications would depend on further research into its biological activity and stability.
Formula:C13H18O3
InChI:InChI=1/C13H18O3/c1-3-11(13(15)16-4-2)12(14)10-8-6-5-7-9-10/h5-9,11-12,14H,3-4H2,1-2H3
SMILES:CCC(C(c1ccccc1)O)C(=O)OCC
Found 1 products.