CymitQuimica logo

CAS 247902-48-3

:

1H-Imidazolium, 1,1'-methylenebis[3-(1,1-dimethylethyl)-, dibromide

Description:
1H-Imidazolium, 1,1'-methylenebis[3-(1,1-dimethylethyl)-, dibromide, identified by CAS number 247902-48-3, is a quaternary ammonium salt characterized by its imidazolium cation structure. This compound features a central imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the methylene bridge and bulky tert-butyl groups enhances its steric hindrance, influencing its solubility and reactivity. The dibromide component indicates that the compound has two bromine atoms, which can impart specific properties such as increased ionic strength and potential applications in various chemical reactions. Typically, imidazolium salts are known for their role as ionic liquids, surfactants, or catalysts in organic synthesis. The stability of this compound can be affected by factors such as temperature and the presence of moisture. Overall, its unique structural features contribute to its utility in both industrial and research applications, particularly in the fields of materials science and catalysis.
Formula:C15H26N4・2Br
InChI:InChI=1S/C15H26N4.2BrH/c1-14(2,3)18-9-7-16(12-18)11-17-8-10-19(13-17)15(4,5)6;;/h7-10,12-13H,11H2,1-6H3;2*1H/q+2;;/p-2
InChI key:WKZMWHMEXVUXBS-UHFFFAOYSA-L
SMILES:CC(C)(C)N1C=C[N+](=C1)C[N+]2=CN(C=C2)C(C)(C)C.[Br-].[Br-]
Found 5 products.