
CAS 248-93-1
:13H-Indeno[1,2-b]anthracene
Description:
13H-Indeno[1,2-b]anthracene, with the CAS number 248-93-1, is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of an indene and anthracene moiety. This compound typically appears as a solid at room temperature and is known for its deep blue fluorescence, making it of interest in organic electronics and photonics. It has a relatively high melting point and is insoluble in water but soluble in organic solvents such as benzene and toluene. The compound exhibits stability under ambient conditions but can undergo photochemical reactions when exposed to UV light. Its unique electronic properties are attributed to the extended π-conjugation across its structure, which facilitates charge transport, making it a candidate for applications in organic semiconductors and light-emitting devices. However, like many PAHs, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C21H14
InChI:InChI=1S/C21H14/c1-2-6-15-10-18-13-21-19(12-17(18)9-14(15)5-1)11-16-7-3-4-8-20(16)21/h1-10,12-13H,11H2
InChI key:InChIKey=WQIFERDZMYSWOI-UHFFFAOYSA-N
SMILES:C=12C(=CC=3C(C1)=CC=4C(C3)=CC=CC4)CC=5C2=CC=CC5
Synonyms:- 13H-Naphtho[2,3-b]fluorene
- 13H-Indeno[1,2-b]anthracene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
