CAS 2484-55-1
:α-L-Sorbofuranose, 2,3-O-(1-methylethylidene)-, 1,6-bis(4-methylbenzenesulfonate)
Description:
α-L-Sorbofuranose, 2,3-O-(1-methylethylidene)-, 1,6-bis(4-methylbenzenesulfonate) is a chemical compound characterized by its unique structural features and functional groups. It is a derivative of L-sorbofuranose, a sugar that exhibits a furanose ring structure, which is a five-membered cyclic form of sugars. The presence of the 2,3-O-(1-methylethylidene) group indicates that the compound has a protective acetal or ketal functionality, which can influence its reactivity and stability. The bis(4-methylbenzenesulfonate) moiety suggests that the compound has two sulfonate groups attached to aromatic rings, enhancing its solubility in polar solvents and potentially increasing its reactivity in various chemical reactions. This compound may be of interest in organic synthesis, particularly in the development of glycosylation reactions or as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, solubility, and reactivity, would depend on the overall molecular structure and the presence of substituents.
Formula:C23H28O10S2
InChI:InChI=1S/C23H28O10S2/c1-15-5-9-17(10-6-15)34(25,26)29-13-19-20(24)21-23(31-19,33-22(3,4)32-21)14-30-35(27,28)18-11-7-16(2)8-12-18/h5-12,19-21,24H,13-14H2,1-4H3/t19-,20+,21-,23-/m0/s1
InChI key:InChIKey=RWMGKKKBAWACGX-KGSLCBSSSA-N
SMILES:C(OS(=O)(=O)C1=CC=C(C)C=C1)[C@]23[C@]([C@H](O)[C@H](COS(=O)(=O)C4=CC=C(C)C=C4)O2)(OC(C)(C)O3)[H]
Synonyms:- Furo[2,3-d]-1,3-dioxole, a-L-sorbofuranose deriv.
- Furo[2,3-d]-1,3-dioxole, α-<span class="text-smallcaps">L</span>-sorbofuranose deriv.
- Sorbofuranose, 2,3-O-isopropylidene-, 1,6-di-p-toluenesulfonate, α-<span class="text-smallcaps">L</span>-
- Sorbofuranose,2,3-O-isopropylidene-, 1,6-di-p-toluenesulfonate, a-L- (7CI,8CI)
- α-<span class="text-smallcaps">L</span>-Sorbofuranose, 2,3-O-(1-methylethylidene)-, 1,6-bis(4-methylbenzenesulfonate)
- Sorbofuranose, 2,3-O-isopropylidene-, 1,6-di-p-toluenesulfonate, α-L-
- α-L-Sorbofuranose, 2,3-O-(1-methylethylidene)-, 1,6-bis(4-methylbenzenesulfonate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,6-Di-O-tosyl-2,3-O-isopropylidene-a-L-sorbofuranose
CAS:Formula:C23H28O10S2Color and Shape:SolidMolecular weight:528.59242,3-O-Isopropylidene-1,6-ditosyl-L-sorbose
CAS:2,3-O-Isopropylidene-1,6-ditosyl-L-sorbose is a biochemical reagent applied in glycobiology research. Glycobiology explores the structure, synthesis, biology, and evolution of sugars, involving carbohydrate chemistry, glycan formation and degradation enzymology, protein-glycan interactions, and the role of glycans in biological systems. This field is closely linked to basic research, biomedicine, and biotechnology.Formula:C23H28O10S2Color and Shape:SolidMolecular weight:528.591,6-Di-O-tosyl-2,3-O-isopropylidene-α-L-sorbofuranose
CAS:Controlled ProductApplications Byproduct obtained during the production of Deoxynojirimycin
Formula:C23H28O10S2Color and Shape:NeatMolecular weight:528.592,3-O-Isopropylidene-1,6-ditosyl-L-sorbose
CAS:Controlled ProductApplications Used in the synthesis of oxy-bridged bicyclic aza-sugar and thio-sugar as potential glycosidase inhibitors.
References Hoffman, D., et al.: Biochemistry, 7, 4479Formula:C23H28O10S2Color and Shape:NeatMolecular weight:528.592,3-O-Isopropylidene-1,6-di-O-p-toluenesulfonyl-a-L-sorbofuranose
CAS:2,3-O-Isopropylidene-1,6-di-O-p-toluenesulfonyl-a-L-sorbofuranose is a synthetic sugar that has been modified with fluorine. It has a molecular weight of 594.65 and melting point of 190°C. The compound is used as a precursor for the synthesis of oligosaccharides and polysaccharides.Formula:C23H28O10S2Purity:Min. 95%Molecular weight:528.59 g/mol




