CAS 2486-75-1
:2-methyl-4-aminobenzoic acid
Description:
2-Methyl-4-aminobenzoic acid, also known as p-aminobenzoic acid (PABA) derivative, is an aromatic carboxylic acid characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) on a benzene ring. The molecular structure features a methyl group (-CH3) attached to the benzene ring at the second position and an amino group at the fourth position, contributing to its unique properties. This compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, which makes it useful in various applications. It is known for its role in the synthesis of folic acid and as a potential UV filter in sunscreens due to its ability to absorb ultraviolet light. Additionally, 2-methyl-4-aminobenzoic acid exhibits mild antibacterial properties and is sometimes used in pharmaceuticals and cosmetics. Its chemical behavior is influenced by the functional groups present, allowing it to participate in various chemical reactions, including acylation and amidation.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=XRSQZFJLEPBPOZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(N)C=C1
Synonyms:- 2-Methyl-p-aminobenzoic acid
- 4-Amino-2-Methyl-Benzoic Acid
- 4-Amino-2-methylbenzoic acid
- Benzoic acid, 4-amino-2-methyl-
- NSC 49299
- o-Toluic acid, 4-amino-
- 2-Methyl-4-aminobenzoic acid
- 4-Amino-2-methybenzoic acid
- 2-METHYL-4-AMINO-BENZOIC ACID
- 4-Amino-o-toluic
- Benzoic acid, 4-amino-2-methyl-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Amino-2-methylbenzoic Acid
CAS:Formula:C8H9NO2Purity:>98.0%(T)(HPLC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:151.174-Amino-2-methylbenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H9NO2Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:151.17Benzoic acid, 4-amino-2-methyl-
CAS:Formula:C8H9NO2Purity:98%Color and Shape:SolidMolecular weight:151.1626Ref: IN-DA002POA
1g20.00€5g25.00€10g28.00€1kgTo inquire25g46.00€50g70.00€100g107.00€250g189.00€500g240.00€4-Amino-2-methylbenzoic acid
CAS:4-Amino-2-methylbenzoic acidPurity:≥95%Color and Shape:Pale Yellow PowderMolecular weight:151.16255g/mol4-Amino-2-methylbenzoic acid
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.1654-Amino-2-methylbenzoic acid
CAS:4-Amino-2-methylbenzoic acid is a low molecular weight compound that has been shown to inhibit the neuraminidase enzyme. It interacts with the imine group of the enzyme and forms a covalent bond, which prevents the release of sialic acid from the terminal sugar residue of glycoproteins. The inhibition of this enzyme leads to decreased bacterial growth. 4-Amino-2-methylbenzoic acid has been shown to be active against Gram positive bacteria such as Staphylococcus aureus and Streptococcus pneumoniae, but not against Gram negative bacteria such as Escherichia coli or Pseudomonas aeruginosa. This compound is also able to inhibit the synthesis of c-reactive protein (CRP) in human erythrocytes.Formula:C8H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:151.16 g/mol







