CAS 24886-03-1
:N-Methyl-L-histidine
Description:
N-Methyl-L-histidine is a derivative of the amino acid histidine, characterized by the presence of a methyl group attached to the nitrogen atom of the imidazole side chain. This modification alters its chemical properties and biological functions compared to its parent compound. N-Methyl-L-histidine is a zwitterionic molecule, meaning it has both positive and negative charges, which contributes to its solubility in water. It is often studied in the context of muscle metabolism and protein synthesis, as it can serve as a marker for muscle turnover. The compound is also of interest in various biochemical research areas, including studies on histidine metabolism and its role in cellular processes. Its CAS number, 24886-03-1, is a unique identifier that facilitates the identification and cataloging of this specific chemical substance in scientific literature and databases. Overall, N-Methyl-L-histidine plays a significant role in understanding amino acid metabolism and its implications in health and disease.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c1-8-6(7(11)12)2-5-3-9-4-10-5/h3-4,6,8H,2H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1
InChI key:InChIKey=CYZKJBZEIFWZSR-LURJTMIESA-N
SMILES:C([C@@H](C(O)=O)NC)C1=CN=CN1
Synonyms:- Histidine, N-methyl-
- α-N-Methylhistidine
- Histidine, N-methyl-, L-
- L-Histidine, N-methyl-
- N-Methyl-L-histidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
