CymitQuimica logo

CAS 2490419-63-9

:

mPEG10-NHS Ester

Description:
mPEG10-NHS Ester, with the CAS number 2490419-63-9, is a chemical compound characterized by its polyethylene glycol (PEG) backbone, which enhances solubility and biocompatibility. The "10" in its name indicates that it has an average molecular weight corresponding to a PEG chain of approximately 10 units, typically around 500 Da. The NHS (N-hydroxysuccinimide) ester functional group is crucial for its reactivity, allowing it to form stable amide bonds with primary amines in proteins or other biomolecules. This property makes mPEG10-NHS Ester particularly valuable in bioconjugation applications, such as drug delivery systems, protein labeling, and the development of therapeutics. The compound is generally soluble in water and organic solvents, making it versatile for various laboratory and industrial applications. Additionally, its low toxicity and ability to improve the pharmacokinetic properties of conjugated molecules further enhance its utility in biomedical research and pharmaceutical development.
Formula:C26H47NO14
InChI:InChI=1S/C26H47NO14/c1-31-6-7-33-10-11-35-14-15-37-18-19-39-22-23-40-21-20-38-17-16-36-13-12-34-9-8-32-5-4-26(30)41-27-24(28)2-3-25(27)29/h2-23H2,1H3
InChI key:AHACEXJKYSNKKI-UHFFFAOYSA-N
SMILES:COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O
Synonyms:
  • mPEG10-NHS Ester
Found 3 products.