CymitQuimica logo

CAS 2490432-02-3

:

Benzoic acid, 3-(aminosulfonyl)-5-(butylnitrosoamino)-4-phenoxy-

Description:
Benzoic acid, 3-(aminosulfonyl)-5-(butylnitrosoamino)-4-phenoxy- is a complex organic compound characterized by its functional groups and structural features. It contains a benzoic acid moiety, which contributes to its acidity and potential for forming salts and esters. The presence of an aminosulfonyl group indicates that it may exhibit properties related to sulfonamide compounds, potentially influencing its solubility and reactivity. The butylnitrosoamino group suggests that the compound may have biological activity, possibly related to nitrosation reactions, which can affect its stability and interaction with biological systems. Additionally, the phenoxy group enhances its potential for various chemical interactions, including hydrogen bonding and electrophilic substitution. Overall, this compound may exhibit unique chemical behavior due to its diverse functional groups, making it of interest in fields such as medicinal chemistry and materials science. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.
Formula:C17H19N3O6S
InChI:InChI=1S/C17H19N3O6S/c1-2-3-9-20(19-23)14-10-12(17(21)22)11-15(27(18,24)25)16(14)26-13-7-5-4-6-8-13/h4-8,10-11H,2-3,9H2,1H3,(H,21,22)(H2,18,24,25)
InChI key:PYLMCQWIQTYALH-UHFFFAOYSA-N
SMILES:CCCCN(C1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2)N=O
Synonyms:
  • Benzoic acid, 3-(aminosulfonyl)-5-(butylnitrosoamino)-4-phenoxy-
  • Bumetanide 3-(Butyl(nitroso)amino)
Found 10 products.