CymitQuimica logo

CAS 24906-75-0

:

2-[(difluoromethyl)sulfonyl]aniline

Description:
2-[(Difluoromethyl)sulfonyl]aniline, with the CAS number 24906-75-0, is an organic compound characterized by the presence of a sulfonyl group attached to an aniline structure. This compound features a difluoromethyl group, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the sulfonyl group, which can engage in hydrogen bonding. The difluoromethyl group enhances the compound's reactivity and can influence its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The sulfonyl moiety is known for its ability to stabilize negative charges, which can be beneficial in certain chemical reactions. Additionally, the compound may exhibit specific biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling, as compounds with sulfonyl and fluorinated groups can pose health and environmental risks.
Formula:C7H7F2NO2S
InChI:InChI=1/C7H7F2NO2S/c8-7(9)13(11,12)6-4-2-1-3-5(6)10/h1-4,7H,10H2
InChI key:LSBGBCYXFNZFJU-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)N)S(=O)(=O)C(F)F
Synonyms:
  • Benzenamine, 2-[(difluoromethyl)sulfonyl]-
  • 2-[(Difluoromethyl)sulfonyl]aniline
Found 3 products.