CAS 2501-02-2
:4,4'-Dinitrostilbene
Description:
4,4'-Dinitrostilbene is an organic compound characterized by its structure, which consists of a stilbene backbone with two nitro groups (-NO2) attached to the para positions of the phenyl rings. This compound typically appears as a yellow crystalline solid and is known for its strong absorption of ultraviolet light, making it useful in various applications, including as a fluorescent dye and in photochemical studies. It is relatively stable under normal conditions but can undergo reduction reactions, leading to the formation of amines. 4,4'-Dinitrostilbene is also notable for its potential use in the synthesis of other chemical compounds and materials, particularly in the field of organic electronics and photonics. However, it is important to handle this compound with care, as nitro compounds can be hazardous and may pose environmental risks. Proper safety protocols should be followed when working with or disposing of 4,4'-dinitrostilbene.
Formula:C14H10N2O4
InChI:InChI=1/C14H10N2O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H/b2-1+
Synonyms:- 1,1'-Ethene-1,2-Diylbis(4-Nitrobenzene)
- 1,1'-(E)-ethene-1,2-diylbis(4-nitrobenzene)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,4'-Dinitrostilbene
CAS:Formula:C14H10N2O4Purity:>98.0%(HPLC)Color and Shape:Yellow to Amber powder to crystalMolecular weight:270.24Benzene, 1,1'-(1,2-ethenediyl)bis[4-nitro-
CAS:Formula:C14H10N2O4Purity:98%Color and Shape:SolidMolecular weight:270.24021-nitro-4-(4-nitroStyryl)benzene
CAS:1-nitro-4-(4-nitroStyryl)benzeneFormula:C14H10N2O4Purity:≥95%Molecular weight:270.24024,4'-Dinitrostilbene
CAS:4,4'-Dinitrostilbene is a neutralizing agent that is used to control the pH of a solution. It can also be used for the treatment of sulfite-induced asthma and for the prevention of methemoglobinemia in nitrate-intoxicated infants. 4,4'-Dinitrostilbene reacts with hydroxyl ions to form an intermediate compound, which reacts with metal ions to form a stable ionic complex. This reaction has been shown to be selective for metal ions such as magnesium and aluminum. The introduction of this compound into a reaction solution causes the formation of hydrogen gas bubbles that are fluorescent in appearance. Hydroxide ions react with this intermediate compound to produce water and nitric oxide gas. This reaction is reversible.Formula:C14H10N2O4Purity:Min. 95%Molecular weight:270.24 g/mol





