CAS 2503-13-1
:4,10,16-trimethyl-6,12,18-tris(1-methylethyl)-3,9,15-tris(1-methylpropyl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Description:
The chemical substance known as "4,10,16-trimethyl-6,12,18-tris(1-methylethyl)-3,9,15-tris(1-methylpropyl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone" with CAS number 2503-13-1 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and a large cyclic framework. This compound features a triazacyclooctadecane core, which is a macrocyclic structure that can exhibit unique coordination properties with metal ions, making it of interest in coordination chemistry. The presence of multiple alkyl substituents, such as trimethyl and tris(1-methylethyl) groups, contributes to its hydrophobic characteristics and may influence its solubility and interaction with biological membranes. Additionally, the presence of oxo groups (indicated by "hexone") suggests potential reactivity and applications in organic synthesis or as a ligand in metal complexation. Overall, this compound's structural complexity and functional diversity make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C36H63N3O9
InChI:InChI=1/C36H63N3O9/c1-16-22(10)25-34(43)46-29(20(6)7)32(41)38(14)27(24(12)18-3)36(45)48-30(21(8)9)33(42)39(15)26(23(11)17-2)35(44)47-28(19(4)5)31(40)37(25)13/h19-30H,16-18H2,1-15H3
SMILES:CCC(C)C1C(=O)OC(C(C)C)C(=O)N(C)C(C(C)CC)C(=O)OC(C(C)C)C(=O)N(C)C(C(C)CC)C(=O)OC(C(C)C)C(=O)N1C
Synonyms:- Baccatin A
- enniatin A
- Lateritin I
- Cyclo[(2R)- 2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl- N-methyl-L- isoleucyl]
- N-Methylcyclo(L-Ile-D-Hmb-N-methyl-L-Ile-D-Hmb-N-methyl-L-Ile-D-Hmb-)
- (3S,6R,9S,12R,15S,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclo[(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl-(2R)-2-hydroxy-3-methylbutanoyl-N-methyl-L-isoleucyl]
CAS:Formula:C36H63N3O9Molecular weight:681.9001Enniatin A
CAS:Enniatin A, a Fusarium toxin, blocks rat liver ACAT with 22 μM IC50.Formula:C36H63N3O9Purity:98%Color and Shape:SolidMolecular weight:681.9Enniatin A
CAS:Enniatin A is a cyclic depsipeptide, which is a secondary metabolite produced by certain Fusarium fungi. It functions as an ionophore, facilitating the transport of ions across cellular membranes. This activity stems from its ability to form complexes with metallic cations, disrupting ion gradients and membrane potential. As a result, Enniatin A can affect various cellular processes, including signal transduction and energy metabolism.Purity:Min. 95%





