CAS 2503-13-1: 4,10,16-trimethyl-6,12,18-tris(1-methylethyl)-3,9,15-tris(1-methylpropyl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
Description:The chemical substance known as "4,10,16-trimethyl-6,12,18-tris(1-methylethyl)-3,9,15-tris(1-methylpropyl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone" with CAS number 2503-13-1 is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and a large cyclic framework. This compound features a triazacyclooctadecane core, which is a macrocyclic structure that can exhibit unique coordination properties with metal ions, making it of interest in coordination chemistry. The presence of multiple alkyl substituents, such as trimethyl and tris(1-methylethyl) groups, contributes to its hydrophobic characteristics and may influence its solubility and interaction with biological membranes. Additionally, the presence of oxo groups (indicated by "hexone") suggests potential reactivity and applications in organic synthesis or as a ligand in metal complexation. Overall, this compound's structural complexity and functional diversity make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C36H63N3O9
InChI:InChI=1/C36H63N3O9/c1-16-22(10)25-34(43)46-29(20(6)7)32(41)38(14)27(24(12)18-3)36(45)48-30(21(8)9)33(42)39(15)26(23(11)17-2)35(44)47-28(19(4)5)31(40)37(25)13/h19-30H,16-18H2,1-15H3