CymitQuimica logo

CAS 25070-73-9

:

4-Morpholinecarboxylic acid, phenylmethyl ester

Description:
4-Morpholinecarboxylic acid, phenylmethyl ester, also known by its CAS number 25070-73-9, is an organic compound characterized by the presence of a morpholine ring and an ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical applications. The morpholine moiety contributes to its basicity and potential reactivity, while the phenylmethyl ester group enhances its lipophilicity. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic reactions. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c14-12(13-6-8-15-9-7-13)16-10-11-4-2-1-3-5-11/h1-5H,6-10H2
InChI key:UYTOAOYDBSKSFI-UHFFFAOYSA-N
SMILES:C1COCCN1C(=O)OCC2=CC=CC=C2
Found 5 products.