CAS 25070-74-0
:Phenylmethyl 1-pyrrolidinecarboxylate
Description:
Phenylmethyl 1-pyrrolidinecarboxylate, also known by its CAS number 25070-74-0, is an organic compound characterized by its ester functional group, which is formed from the reaction of phenylmethyl alcohol and 1-pyrrolidinecarboxylic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a relatively low volatility and is soluble in organic solvents, making it useful in various chemical applications. The presence of the pyrrolidine ring contributes to its potential biological activity, as compounds containing this structure are often associated with pharmacological properties. Additionally, the phenylmethyl group can enhance lipophilicity, influencing the compound's interaction with biological membranes. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, Phenylmethyl 1-pyrrolidinecarboxylate is of interest in both synthetic organic chemistry and potential medicinal applications.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2
InChI key:InChIKey=VALPXRNQZYGXPS-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CCCC2
Synonyms:- N-Carbobenzyloxypyrrolidine
- 1-Pyrrolidinecarboxylic acid, phenylmethyl ester
- N-(Benzyloxycarbonyl)pyrrolidine
- Phenylmethyl 1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid benzyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
benzyl pyrrolidine-1-carboxylate
CAS:Formula:C12H15NO2Purity:97%Color and Shape:LiquidMolecular weight:205.25301-Cbz-pyrrolidine
CAS:1-Cbz-pyrrolidine is a substrate for the reaction of hydroxylation with recombinant Escherichia coli. It was used as a model substrate to study the effects of concentration and stereoselectivity on the rate of reaction. A preparative scale reaction was carried out using 1-Cbz-pyrrolidine in order to examine the effect of substrate concentration on product yield. The immobilization of 1-Cbz-pyrrolidine onto an insoluble support material was then investigated in order to determine the suitability of this process for the preparation of a reusable bioreactor. Immobilization led to an increase in activity, and therefore immobilizing 1-Cbz-pyrrolidine onto an insoluble support material is a feasible method for its preparation as a reusable bioreactor.Formula:C12H15NO2Purity:Min. 95%Molecular weight:205.26 g/mol




