CymitQuimica logo

CAS 251115-21-6

:

4-Bromo-2-nitro-1-(trifluoromethyl)benzene

Description:
4-Bromo-2-nitro-1-(trifluoromethyl)benzene is an aromatic compound characterized by the presence of a bromine atom, a nitro group, and a trifluoromethyl group attached to a benzene ring. The molecular structure features a bromine substituent at the para position relative to the nitro group and a trifluoromethyl group at the meta position. This compound is typically a solid at room temperature and exhibits a pale yellow to brown color. It is known for its relatively high stability due to the resonance stabilization of the aromatic ring. The presence of the electron-withdrawing nitro and trifluoromethyl groups significantly influences its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's unique electronic properties can affect its solubility and interaction with other chemical species. Safety precautions should be taken when handling this substance, as it may pose health risks and environmental hazards.
Formula:C7H3BrF3NO2
InChI:InChI=1/C7H3BrF3NO2/c8-4-1-2-5(7(9,10)11)6(3-4)12(13)14/h1-3H
InChI key:WPDWGHAFCXNYDI-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)N(=O)=O)C(F)(F)F
Synonyms:
  • Benzene, 4-Bromo-2-Nitro-1-(Trifluoromethyl)-
  • 4-Bromo-2-nitrobenzotrifluoride
Found 4 products.