CymitQuimica logo

CAS 2516-99-6

:

3,3,3-trifluoropropionic acid

Description:
3,3,3-Trifluoropropionic acid is a fluorinated carboxylic acid characterized by the presence of three fluorine atoms attached to the third carbon of a propionic acid backbone. Its molecular formula is C3H3F3O2, and it features a carboxylic acid functional group (-COOH), which imparts acidic properties. This compound is typically a colorless liquid at room temperature and is known for its strong acidity, which is enhanced by the electronegative fluorine atoms that stabilize the carboxylate ion upon deprotonation. 3,3,3-Trifluoropropionic acid is soluble in polar solvents, including water, due to its ability to form hydrogen bonds. It is used in various applications, including as a reagent in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms can influence the compound's reactivity and stability, making it of interest in materials science and chemical research. Safety precautions should be taken when handling this substance, as it can be corrosive and harmful if ingested or inhaled.
Formula:C3H2F3O2
InChI:InChI=1/C3H3F3O2/c4-3(5,6)1-2(7)8/h1H2,(H,7,8)/p-1
InChI key:KSNKQSPJFRQSEI-UHFFFAOYSA-N
SMILES:C(C(=O)[O-])C(F)(F)F
Synonyms:
  • 3,3,3-Trifluoro-propionic acid
  • 3,3,3-Trifluoropropanoic Acid
  • 3,3,3-Trifluoropropanoate
Found 5 products.