CAS 2517-04-6
:(±)-2-Azetidinecarboxylic acid
Description:
(±)-2-Azetidinecarboxylic acid, also known as proline, is a cyclic amino acid characterized by its five-membered ring structure containing a nitrogen atom. This compound is notable for its role in protein synthesis and is classified as a non-essential amino acid, meaning that the body can synthesize it. The presence of the carboxylic acid functional group contributes to its acidic properties, while the nitrogen atom in the ring provides basic characteristics. This dual functionality allows proline to participate in various biochemical reactions. It is also known for its unique ability to induce bends in protein structures, influencing the overall conformation of proteins. The compound is typically found in a racemic mixture, consisting of both enantiomers, which can exhibit different biological activities. Proline is soluble in water and has applications in pharmaceuticals, food, and cosmetic industries due to its stabilizing properties and role in collagen synthesis. Its structural characteristics and biological significance make it a subject of interest in both research and industrial applications.
Formula:C4H7NO2
InChI:InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)
InChI key:InChIKey=IADUEWIQBXOCDZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCN1
Synonyms:- 2-Azetidinecarboxylic acid
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-2-Azetidinecarboxylic acid
- DL-2-Azetidinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Azetidine-2-carboxylic acid
CAS:Azetidine-2-carboxylic acidFormula:C4H7NO2Purity:≥98%Molecular weight:101.1Azetidine-2-carboxylic acid
CAS:Azetidine-2-carboxylic acidFormula:C4H7NO2Purity:95%Color and Shape:SolidMolecular weight:101.103882-Azetidinecarboxylic acid
CAS:Formula:C4H7NO2Purity:97%Color and Shape:SolidMolecular weight:101.1039Azetidine-2-carboxylic Acid
CAS:Formula:C4H7NO2Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:101.11Azetidine-2-carboxylic acid
CAS:Non-proteinogenic amino acid, similar to proline, found in beets; misincorporated in proteins, toxic and teratogenic.Formula:C4H7NO2Purity:98.97%Color and Shape:SolidMolecular weight:101.1Azetidine-2-carboxylic acid
CAS:Formula:C4H7NO2Purity:97%Color and Shape:LiquidMolecular weight:101.105D,L-Azetidine-2-carboxylic Acid-d4
CAS:Controlled ProductApplications D,L-Azetidine-2-carboxylic Acid-d4 is the isotope labelled analog of D,L-Azetidine-2-carboxylic Acid (A812490); a four-membered ring analog of L-Proline and a useful intermediate in the synthesis of polypeptides.
References Barber, M., et al.: Int. J. Pept. Protein Res., 14(3), 247 (1979); Tsai., F.H., et al.: Biopolymers, 30(11-12), 1039 (1990)Formula:C4D4H3NO2Color and Shape:NeatMolecular weight:105.129D,L-Azetidine-2-carboxylic Acid-d5
CAS:Controlled ProductApplications D,L-Azetidine-2-carboxylic Acid-d5 is a useful synthetic intermediate.
Formula:C4D5H2NO2Color and Shape:NeatMolecular weight:106.135






