CAS 25186-47-4
:1,3-Dichloro-5-methylbenzene
Description:
1,3-Dichloro-5-methylbenzene, also known as pseudocumene dichloride, is an aromatic compound characterized by a benzene ring substituted with two chlorine atoms and a methyl group. Its molecular formula is C8H8Cl2, indicating the presence of eight carbon atoms, eight hydrogen atoms, and two chlorine atoms. This compound typically appears as a colorless to pale yellow liquid with a distinct aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol and ether. The presence of chlorine atoms contributes to its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of agrochemicals and pharmaceuticals. Additionally, 1,3-Dichloro-5-methylbenzene may pose environmental and health risks, necessitating careful handling and adherence to safety regulations. Its physical properties, such as boiling point and density, can vary based on specific conditions, but it generally exhibits typical characteristics of chlorinated aromatic compounds.
Formula:C7H6Cl2
InChI:InChI=1S/C7H6Cl2/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3
InChI key:InChIKey=RYMMNSVHOKXTNN-UHFFFAOYSA-N
SMILES:CC1=CC(Cl)=CC(Cl)=C1
Synonyms:- 1,3-Dichloro-5-Methylbenzene
- Benzene, 1,3-dichloro-5-methyl-
- Toluene, 3,5-dichloro-
- 3,5-Dichlorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzene, 1,3-dichloro-5-methyl-
CAS:Formula:C7H6Cl2Purity:98%Color and Shape:SolidMolecular weight:161.02853,5-Dichlorotoluene (Standard)
CAS:3,5-Dichlorotoluene (Standard) is a reference standard of 3,5-Dichlorotoluene intended for quantitative analysis, quality control, and related biochemical research applications.Formula:C7H6Cl2Color and Shape:SolidMolecular weight:161.033,5-Dichlorotoluene
CAS:3,5-DichlorotolueneFormula:C7H6Cl2Purity:98%Color and Shape:Solid-Low MeltMolecular weight:161.028543,5-Dichlorotoluene
CAS:Controlled ProductApplications 3,5-Dichlorotoluene is a common chemical reactant used in the synthesis of various pharmaceuticals and biological agents. Used in the preparation of pyrazole amide derivatives as RORγ inhibitors as well as cross coupling reactions.
References WO Patent 2015129926 (Sep 3, 2015); Sun, X. et al.: Angew. Chem., Int. Ed., 52, 4440 (2013);Formula:C7H6Cl2Color and Shape:NeatMolecular weight:161.033,5-Dichlorotoluene
CAS:Formula:C7H6Cl2Purity:98%Color and Shape:Solid, Low Melting SolidMolecular weight:161.03






