CymitQuimica logo

CAS 252340-70-8

:

3-Fluoro-4-(4-methyl-1H-imidazol-1-yl)aniline

Description:
3-Fluoro-4-(4-methyl-1H-imidazol-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a fluorine atom and an imidazole ring. The presence of the fluorine substituent at the meta position relative to the amino group enhances the compound's electronic properties, potentially influencing its reactivity and solubility. The imidazole moiety contributes to the compound's biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the amino and imidazole functional groups. Its synthesis generally involves the introduction of the fluorine atom and the imidazole ring onto the aniline backbone, which can be achieved through various organic reactions. The compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the substance. As with many fluorinated compounds, it may exhibit unique interactions with biological systems, making it of interest in medicinal chemistry.
Formula:C10H10FN3
InChI:InChI=1/C10H10FN3/c1-7-5-14(6-13-7)10-3-2-8(12)4-9(10)11/h2-6H,12H2,1H3
InChI key:XUDKNXYCYIYBIG-UHFFFAOYSA-N
SMILES:Cc1cn(cn1)c1ccc(cc1F)N
Synonyms:
  • 3-Fluor-4-(4-methyl-1H-imidazol-1-yl)anilin
  • benzenamine, 3-fluoro-4-(4-methyl-1H-imidazol-1-yl)-
  • 3-fluoro-4-(4-methyl-1H-imidazol-1-yl)benzenamine
Found 2 products.