CAS 25244-68-2

10H-phenothiazin-10-ylacetic acid

Description:

10H-phenothiazin-10-ylacetic acid, with the CAS number 25244-68-2, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in organic solvents. It is known for its potential biological activity, particularly in the field of pharmaceuticals, where derivatives of phenothiazine are often explored for their antipsychotic and anti-inflammatory properties. The presence of the acetic acid moiety in its structure may contribute to its reactivity and interaction with biological systems. Additionally, the compound may exhibit various functional groups that influence its chemical behavior, including acidity and potential for forming salts. Overall, 10H-phenothiazin-10-ylacetic acid is of interest in medicinal chemistry and may serve as a lead compound for further drug development.

Formula: C₁₄H₁₁NO₂S

InChI: InChI=1/C14H11NO2S/c16-14(17)9-15-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)15/h1-8H,9H2,(H,16,17)

InChI key: QUJVFIOYSMVYGY-UHFFFAOYSA-N

SMILES: c1ccc2c(c1)N(CC(=O)O)c1ccccc1S2

Synonyms:

• 10H-phenothiazine-10-acetic acid
• 2-(10H-phenothiazin-10-yl)acetic acid
• 10H-Phenothiazin-10-ylacetic acid
• PHENOTHIAZINE-10-ACETIC ACID
• Phenothiazin-10-yl-acetic acid

2-(10H-Phenothiazin-10-yl)acetic acid

CAS: 25244-68-2

2-(10H-Phenothiazin-10-yl)acetic acid

Formula: C₁₄H₁₁NO₂S

Purity: 95%

Molecular weight: 257.31

Ref: 54-OR1141356

2-(10h-Phenothiazin-10-yl)acetic acid

CAS: 25244-68-2

Formula: C₁₄H₁₁NO₂S

Purity: %

Molecular weight: 257.3076

Ref: IN-DA006WOD

2-(10h-Phenothiazin-10-yl)acetic acid

CAS: 25244-68-2

Purity: 95+%

Molecular weight: 257.3099976

Ref: 10-F639834

2-(10H-Phenothiazin-10-yl)acetic acid

CAS: 25244-68-2

The 2-(10H-phenothiazine-10-yl)acetic acid (2PTA) is a protonated molecule that has been studied computationally and experimentally in order to understand its supramolecular properties. It was found that 2PTA can be protonated at the C2 position by simulated light, leading to a change in properties. This molecule may have applications as a photoactive material for supramolecular assembly, as well as as a photochromic agent for DNA sequences. The compound also has the ability to bind nucleobases and flavin, which are used in DNA synthesis and repair.

Formula: C₁₄H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 257.31 g/mol

Ref: 3D-ABA24468