CAS 25249-54-1
:Polyvinylpolypyrrolidone cross-linked
Description:
Polyvinylpolypyrrolidone cross-linked, commonly referred to as cross-linked polyvinylpyrrolidone (PVP), is a synthetic polymer known for its versatile applications in various fields, including pharmaceuticals, cosmetics, and food industries. This substance is characterized by its high molecular weight and cross-linked structure, which enhances its stability and solubility in water. PVP exhibits excellent binding properties, making it an effective excipient in tablet formulations and a stabilizer in emulsions and suspensions. Additionally, it possesses film-forming capabilities, which contribute to its use in cosmetic products for hair and skin. The polymer is generally regarded as non-toxic and biocompatible, which further supports its use in medical applications, such as drug delivery systems. Its ability to form gels and its hygroscopic nature allow it to retain moisture, making it beneficial in formulations requiring hydration. Overall, cross-linked polyvinylpyrrolidone is valued for its multifunctionality, safety profile, and effectiveness in enhancing the performance of various products.
Formula:C6H9NO
InChI:InChI=1/C6H9NO/c1-2-7-5-3-4-6(7)8/h2H,1,3-5H2
SMILES:C=CN1CCCC1=O
Synonyms:- 1-Ethenylpyrrolidin-2-One
- Crosslinked Povidone
- PVP cross-linked
- Poly[1-(2-oxo-1-pyrrolidinyl)-1,2-ethanediyl]
- Poly[1-(2-oxo-1-pyrrolidinyl)ethylene]
- Polyvinylpyrrolidone cross-linked
- Povidone cross-linked
- Pvpp
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Polyvinylpyrrolidone, cross linked
CAS:Polyvinylpyrrolidone is used in coatings, printing ink, rubber, glass, leather, cosmetics, soaps, plastics, in paper making and as a stabilizer. It acts as a disintegrant in pharmaceutical tablets and as a fining to extract impurities. It is used to remove polyphenols in beer. This Thermo ScientifiFormula:(C6H9NO)nColor and Shape:White to off-white, PowderPoly(vinylpolypyrrolidone)
CAS:Poly(vinylpolypyrrolidone)Formula:(C6H9NO)nPurity:40-60μmColor and Shape:SolidPoly(vinylpolypyrrolidone)
CAS:Poly(vinylpolypyrrolidone)Formula:(C6H9NO)nPurity:powderColor and Shape:Solid-Powder

