CymitQuimica logo

CAS 252681-57-5

:

2-Chloro-4,6-difluorobenzothiazole

Description:
2-Chloro-4,6-difluorobenzothiazole is a heterocyclic organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features two fluorine atoms and one chlorine atom substituted on the benzene ring, specifically at the 4 and 6 positions for the fluorines and the 2 position for the chlorine. It is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique reactivity and biological activity. The presence of halogen substituents often enhances the compound's lipophilicity and can influence its interaction with biological targets. Additionally, 2-chloro-4,6-difluorobenzothiazole may exhibit properties such as moderate stability under standard conditions, but it should be handled with care due to potential toxicity and environmental impact. As with many halogenated compounds, it is important to consider its behavior in various chemical environments, including its reactivity and potential for degradation.
Formula:C7H2ClF2NS
InChI:InChI=1S/C7H2ClF2NS/c8-7-11-6-4(10)1-3(9)2-5(6)12-7/h1-2H
InChI key:LZXONCQHRWRSKB-UHFFFAOYSA-N
SMILES:C1=C(C=C2C(=C1F)N=C(S2)Cl)F
Found 4 products.