CymitQuimica logo

CAS 25279-15-6

:

Dammaran-3-one,20,24-epoxy-12,25-dihydroxy-, (12b,24R)-

Description:
Dammaran-3-one,20,24-epoxy-12,25-dihydroxy-, (12b,24R)- is a triterpenoid compound characterized by its complex polycyclic structure, which includes a dammarane skeleton. This substance features a ketone functional group at the C-3 position, an epoxy group between C-20 and C-24, and hydroxyl groups at the C-12 and C-25 positions, contributing to its biological activity. The stereochemistry indicated by (12b,24R) suggests specific spatial arrangements of atoms that can influence its interaction with biological systems. Triterpenoids like this compound are often studied for their potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The presence of multiple functional groups enhances its reactivity and solubility in various solvents, making it a subject of interest in medicinal chemistry and natural product research. Additionally, the compound's unique structure may lead to specific interactions with cellular targets, warranting further investigation into its therapeutic potential.
Formula:C30H50O4
InChI:InChI=1S/C30H50O4/c1-25(2)20-10-15-28(6)21(27(20,5)13-11-22(25)32)17-19(31)24-18(9-14-29(24,28)7)30(8)16-12-23(34-30)26(3,4)33/h18-21,23-24,31,33H,9-17H2,1-8H3/t18-,19+,20-,21+,23+,24-,27-,28+,29+,30-/m0/s1
InChI key:MOCDJPYINJXPKU-BDSQRYQESA-N
SMILES:C[C@]1(CC[C@@H](O1)C(C)(C)O)[C@H]2CC[C@@]3([C@@H]2[C@@H](C[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)O)C
Synonyms:
  • Dammaran-3-one,20,24-epoxy-12b,25-dihydroxy-,(20S,24R)-
  • 3-Dehydropyxinol
  • 20S,24R-Epoxydammar-12,25-diol-3-one
Found 4 products.