CymitQuimica logo

CAS 252932-49-3

:

3-Amino-2-ethoxycarbonylpyrrole hydrochloride

Description:
3-Amino-2-ethoxycarbonylpyrrole hydrochloride is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of an amino group and an ethoxycarbonyl group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions and biological studies. The compound may exhibit properties such as basicity due to the amino group and can participate in various chemical transformations, including acylation and alkylation. Its specific applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use. Overall, 3-Amino-2-ethoxycarbonylpyrrole hydrochloride represents a versatile building block in organic chemistry.
Formula:C7H11ClN2O2
InChI:InChI=1/C7H10N2O2.ClH/c1-2-11-7(10)6-5(8)3-4-9-6;/h3-4,9H,2,8H2,1H3;1H
InChI key:MWWQOUGXCWIOSR-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(cc[nH]1)N.Cl
Synonyms:
  • 2-(ethoxycarbonyl)-1H-pyrrol-3-aminium chloride
  • ethyl 3-amino-1H-pyrrole-2-carboxylate hydrochloride
  • 3-amino-2-ethoxycarbonylpyrrole.hydrochloride
Found 4 products.