CAS 2536-35-8

16-bromohexadecanoic acid

Description:

16-Bromohexadecanoic acid, with the CAS number 2536-35-8, is a long-chain fatty acid derivative characterized by the presence of a bromine atom at the 16th carbon position of the hexadecanoic acid (palmitic acid) chain. This compound typically appears as a white to off-white solid or waxy substance. It is soluble in organic solvents such as chloroform and methanol but has limited solubility in water due to its hydrophobic long carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, including the preparation of surfactants, emulsifiers, and other functionalized compounds. Additionally, it may exhibit biological activity, which can be explored in pharmaceutical or biochemical research. The compound's melting and boiling points, as well as its stability, can be influenced by the bromine substitution, affecting its physical properties and reactivity in different environments. Overall, 16-bromohexadecanoic acid serves as an important intermediate in organic synthesis and materials science.

Formula: C₁₆H₃₁BrO₂

InChI: InChI=1/C16H31BrO2/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15H2,(H,18,19)

SMILES: C(CCCCCCCC(=O)O)CCCCCCCBr

16-Bromohexadecanoic acid

CAS: 2536-35-8

Formula: C₁₆H₃₁BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 335.3201

Ref: IN-DA003DVI

16-Bromohexadecanoic Acid

CAS: 2536-35-8

Formula: C₁₆H₃₁BrO₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 335.33

Ref: 3B-B6915

16-Bromohexadecanoic acid

CAS: 2536-35-8

Purity: >95%

Molecular weight: 335.32

Ref: FT-B36068

16-Bromohexadecanoic acid

CAS: 2536-35-8

16-Bromohexadecanoic acid

Formula: C₁₆H₃₁BrO₂

Purity: 98%

Color and Shape: white solid

Molecular weight: 335.32g/mol

Ref: 54-OR6482

16-Bromohexadecanoic acid

CAS: 2536-35-8

Formula: C₁₆H₃₁BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 335.326

Ref: 10-F465265