CymitQuimica logo

CAS 2536-35-8

:

16-bromohexadecanoic acid

Description:
16-Bromohexadecanoic acid, with the CAS number 2536-35-8, is a long-chain fatty acid derivative characterized by the presence of a bromine atom at the 16th carbon position of the hexadecanoic acid (palmitic acid) chain. This compound typically appears as a white to off-white solid or waxy substance. It is soluble in organic solvents such as chloroform and methanol but has limited solubility in water due to its hydrophobic long carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical synthesis applications, including the preparation of surfactants, emulsifiers, and other functionalized compounds. Additionally, it may exhibit biological activity, which can be explored in pharmaceutical or biochemical research. The compound's melting and boiling points, as well as its stability, can be influenced by the bromine substitution, affecting its physical properties and reactivity in different environments. Overall, 16-bromohexadecanoic acid serves as an important intermediate in organic synthesis and materials science.
Formula:C16H31BrO2
InChI:InChI=1/C16H31BrO2/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15H2,(H,18,19)
InChI key:PFNCOYVEMJYEED-UHFFFAOYSA-N
SMILES:C(CCCCCCCC(=O)O)CCCCCCCBr
Found 8 products.