CAS 25368-11-0: Asperulosidic acid
Description:Asperulosidic acid is a naturally occurring iridoid glycoside, primarily found in various plant species, particularly in the Rubiaceae family. It is characterized by its complex molecular structure, which includes a sugar moiety attached to an iridoid core. This compound is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. Asperulosidic acid is often studied for its role in traditional medicine and its potential therapeutic applications. It is typically soluble in polar solvents, which facilitates its extraction from plant materials. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, its presence in herbal formulations highlights its significance in phytochemistry and natural product research. Overall, Asperulosidic acid represents an interesting subject of study due to its bioactive properties and potential health benefits.
Formula:C18H24O12
InChI:InChI=1S/C18H24O12/c1-6(20)27-4-7-2-9(21)12-8(16(25)26)5-28-17(11(7)12)30-18-15(24)14(23)13(22)10(3-19)29-18/h2,5,9-15,17-19,21-24H,3-4H2,1H3,(H,25,26)/t9-,10+,11+,12-,13+,14-,15+,17-,18-/m0/s1
InChI key:InChIKey=DGDWCRWJRNMRKX-DILZHRMZSA-N
SMILES:O=C(O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C3C(=CC(O)C13)COC(=O)C
- Synonyms:
- Cyclopenta[c]pyran-4-carboxylic acid, 1α-(β-D-glucopyranosyloxy)-1,4aα,5,7aα-tetrahydro-5β-hydroxy-7-(hydroxymethyl)-, 7-acetate
- (1S,4aS,5S,7aS)-7-[(Acetyloxy)methyl]-1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxycyclopenta[c]pyran-4-carboxylic acid
- Cyclopenta[c]pyran-4-carboxylic acid, 7-[(acetyloxy)methyl]-1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-, (1S,4aS,5S,7aS)-
- Asperulosidic acid
- Cyclopenta[c]pyran-4-carboxylic acid, 7-[(acetyloxy)methyl]-1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-, [1S-(1α,4aα,5β,7aα)]-
