CymitQuimica logo

CAS 25391-57-5

:

5-Iodo-3-nitro-2-pyridinamine

Description:
5-Iodo-3-nitro-2-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an iodine atom at the 5-position and a nitro group at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its functional groups, particularly the nitro and amino groups, can participate in various chemical reactions, such as nucleophilic substitutions and reductions. The compound's structure suggests potential biological activity, making it of interest for research in pharmaceuticals. Safety data indicates that, like many halogenated and nitro compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 5-Iodo-3-nitro-2-pyridinamine serves as a valuable building block in synthetic chemistry and drug development.
Formula:C5H4IN3O2
InChI:InChI=1S/C5H4IN3O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H,(H2,7,8)
InChI key:InChIKey=MDJUWRHSXKZSOJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)N=CC(I)=C1
Synonyms:
  • 2-Pyridinamine, 5-Iodo-3-Nitro-
  • 5-Iodo-3-nitro-2-pyridinamine
  • 5-Iodo-3-nitropyridin-2-amine
  • Pyridine, 2-amino-5-iodo-3-nitro-
  • 2-Amino-5-iodo-3-nitropyridine
Found 4 products.