CymitQuimica logo

CAS 254-60-4

:

1,8-Naphthyridine

Description:
1,8-Naphthyridine is a heterocyclic organic compound characterized by a bicyclic structure that consists of a naphthalene ring fused with a pyridine ring. It features a nitrogen atom located at the 1 and 8 positions of the naphthalene framework, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its aromatic nature, which imparts stability and reactivity. 1,8-Naphthyridine exhibits basic properties due to the presence of the nitrogen atom, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. It is soluble in organic solvents and has applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in agrochemicals and dyes. Additionally, its derivatives are of interest in research for their potential biological activities, including antimicrobial and antitumor properties.
Formula:C8H6N2
InChI:InChI=1S/C8H6N2/c1-3-7-4-2-6-10-8(7)9-5-1/h1-6H
InChI key:InChIKey=FLBAYUMRQUHISI-UHFFFAOYSA-N
SMILES:C12=C(N=CC=C1)N=CC=C2
Synonyms:
  • 1,8-Diazanaphthalene
  • 1,8-Naphthyridine
  • 1,8-Pyridopyridine
Found 6 products.