CymitQuimica logo

CAS 254755-24-3

:

9,9-Dihexylfluorene-2,7-bis(boronic acid pinacol ester)

Description:
9,9-Dihexylfluorene-2,7-bis(boronic acid pinacol ester) is an organoboron compound characterized by its unique structure, which includes a fluorene backbone substituted with two boronic acid pinacol esters at the 2 and 7 positions. This compound exhibits properties typical of boron-containing organic materials, such as good thermal stability and potential for use in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). The presence of the hexyl groups enhances its solubility in organic solvents, facilitating processing and application in various organic synthesis and materials science contexts. Additionally, the boronic acid esters can participate in Suzuki coupling reactions, making this compound valuable for further functionalization and the development of complex organic structures. Its molecular design allows for tunable electronic properties, which can be tailored for specific applications in optoelectronic devices. Overall, this compound represents a significant interest in the field of organic chemistry and materials science due to its versatile reactivity and potential applications.
Formula:C37H56B2O4
InChI:InChI=1S/C37H56B2O4/c1-11-13-15-17-23-37(24-18-16-14-12-2)31-25-27(38-40-33(3,4)34(5,6)41-38)19-21-29(31)30-22-20-28(26-32(30)37)39-42-35(7,8)36(9,10)43-39/h19-22,25-26H,11-18,23-24H2,1-10H3
InChI key:SYMMYBWUPCWTEI-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=C(C3(CCCCCC)CCCCCC)C=C(C=C4)B5OC(C(O5)(C)C)(C)C
Found 4 products.